C21H21NO3 — CID 7852992
[(2R)-1-[(2R)-2-methyl-2,3-dihydroindol-1-yl]-1-oxopropan-2-yl] (E)-3-phenylprop-2-enoate (PubChem CID 7852992) has the molecular formula C21H21NO3 and a molecular weight of 335.40 g/mol. Its IUPAC name is [(2R)-1-[(2R)-2-methyl-2,3-dihydroindol-1-yl]-1-oxopropan-2-yl] (E)-3-phenylprop-2-enoate.
| Compound Name | [(2R)-1-[(2R)-2-methyl-2,3-dihydroindol-1-yl]-1-oxopropan-2-yl] (E)-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 7852992 |
| Molecular Formula | C21H21NO3 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | [(2R)-1-[(2R)-2-methyl-2,3-dihydroindol-1-yl]-1-oxopropan-2-yl] (E)-3-phenylprop-2-enoate |
| SMILES | C[C@@H]1Cc2ccccc2N1C(=O)[C@@H](C)OC(=O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C21H21NO3/c1-15-14-18-10-6-7-11-19(18)22(15)21(24)16(2)25-20(23)13-12-17-8-4-3-5-9-17/h3-13,15-16H,14H2,1-2H3/b13-12+/t15-,16-/m1/s1 |
| InChIKey | ROHWPRGRKDEVTK-ZTMCPOQVSA-N |
| XLogP | 3.61 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|