C21H20N2O5 — CID 7852595
[(2S)-1-[(2R)-2-methyl-2,3-dihydroindol-1-yl]-1-oxopropan-2-yl] (E)-3-(4-nitrophenyl)prop-2-enoate (PubChem CID 7852595) has the molecular formula C21H20N2O5 and a molecular weight of 380.40 g/mol. Its IUPAC name is [(2S)-1-[(2R)-2-methyl-2,3-dihydroindol-1-yl]-1-oxopropan-2-yl] (E)-3-(4-nitrophenyl)prop-2-enoate.
| Compound Name | [(2S)-1-[(2R)-2-methyl-2,3-dihydroindol-1-yl]-1-oxopropan-2-yl] (E)-3-(4-nitrophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 7852595 |
| Molecular Formula | C21H20N2O5 |
| Molecular Weight | 380.40 g/mol |
| Exact Mass | 380.14 |
| IUPAC Name | [(2S)-1-[(2R)-2-methyl-2,3-dihydroindol-1-yl]-1-oxopropan-2-yl] (E)-3-(4-nitrophenyl)prop-2-enoate |
| SMILES | C[C@H](OC(=O)/C=C/c1ccc([N+](=O)[O-])cc1)C(=O)N1c2ccccc2C[C@H]1C |
| InChI | InChI=1S/C21H20N2O5/c1-14-13-17-5-3-4-6-19(17)22(14)21(25)15(2)28-20(24)12-9-16-7-10-18(11-8-16)23(26)27/h3-12,14-15H,13H2,1-2H3/b12-9+/t14-,15+/m1/s1 |
| InChIKey | OUAPQXVSMWZZNC-NZETUCKYSA-N |
| XLogP | 3.52 |
| TPSA | 89.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.40 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|