C18H15ClFNO — CID 16547585
(E)-3-(3-chloro-4-fluorophenyl)-1-(2-methyl-2,3-dihydroindol-1-yl)prop-2-en-1-one (PubChem CID 16547585) has the molecular formula C18H15ClFNO and a molecular weight of 315.78 g/mol. Its IUPAC name is (E)-3-(3-chloro-4-fluorophenyl)-1-(2-methyl-2,3-dihydroindol-1-yl)prop-2-en-1-one.
| Compound Name | (E)-3-(3-chloro-4-fluorophenyl)-1-(2-methyl-2,3-dihydroindol-1-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 16547585 |
| Molecular Formula | C18H15ClFNO |
| Molecular Weight | 315.78 g/mol |
| Exact Mass | 315.08 |
| IUPAC Name | (E)-3-(3-chloro-4-fluorophenyl)-1-(2-methyl-2,3-dihydroindol-1-yl)prop-2-en-1-one |
| SMILES | CC1Cc2ccccc2N1C(=O)/C=C/c1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C18H15ClFNO/c1-12-10-14-4-2-3-5-17(14)21(12)18(22)9-7-13-6-8-16(20)15(19)11-13/h2-9,11-12H,10H2,1H3/b9-7+ |
| InChIKey | QHIBRWGIDOOGOH-VQHVLOKHSA-N |
| XLogP | 4.47 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.78 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|