C17H18N2S — CID 19686679
2-methyl-N-(3-methylphenyl)-2,3-dihydroindole-1-carbothioamide (PubChem CID 19686679) has the molecular formula C17H18N2S and a molecular weight of 282.41 g/mol. Its IUPAC name is 2-methyl-N-(3-methylphenyl)-2,3-dihydroindole-1-carbothioamide.
| Compound Name | 2-methyl-N-(3-methylphenyl)-2,3-dihydroindole-1-carbothioamide |
|---|---|
| PubChem CID | 19686679 |
| Molecular Formula | C17H18N2S |
| Molecular Weight | 282.41 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | 2-methyl-N-(3-methylphenyl)-2,3-dihydroindole-1-carbothioamide |
| SMILES | Cc1cccc(NC(=S)N2c3ccccc3CC2C)c1 |
| InChI | InChI=1S/C17H18N2S/c1-12-6-5-8-15(10-12)18-17(20)19-13(2)11-14-7-3-4-9-16(14)19/h3-10,13H,11H2,1-2H3,(H,18,20) |
| InChIKey | FTNSTQQXTGOGDH-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.41 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|