C30H24N4S — CID 126338049
(2R)-N-(2,3-diphenylquinoxalin-6-yl)-2-methyl-2,3-dihydroindole-1-carbothioamide (PubChem CID 126338049) has the molecular formula C30H24N4S and a molecular weight of 472.62 g/mol. Its IUPAC name is (2R)-N-(2,3-diphenylquinoxalin-6-yl)-2-methyl-2,3-dihydroindole-1-carbothioamide.
| Compound Name | (2R)-N-(2,3-diphenylquinoxalin-6-yl)-2-methyl-2,3-dihydroindole-1-carbothioamide |
|---|---|
| PubChem CID | 126338049 |
| Molecular Formula | C30H24N4S |
| Molecular Weight | 472.62 g/mol |
| Exact Mass | 472.17 |
| IUPAC Name | (2R)-N-(2,3-diphenylquinoxalin-6-yl)-2-methyl-2,3-dihydroindole-1-carbothioamide |
| SMILES | C[C@@H]1Cc2ccccc2N1C(=S)Nc1ccc2nc(-c3ccccc3)c(-c3ccccc3)nc2c1 |
| InChI | InChI=1S/C30H24N4S/c1-20-18-23-14-8-9-15-27(23)34(20)30(35)31-24-16-17-25-26(19-24)33-29(22-12-6-3-7-13-22)28(32-25)21-10-4-2-5-11-21/h2-17,19-20H,18H2,1H3,(H,31,35)/t20-/m1/s1 |
| InChIKey | DZCCEWQGQJWDMN-HXUWFJFHSA-N |
| XLogP | 7.11 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.62 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|