C23H22N2O2S2 — CID 3280591
ethyl 2-[(2-methyl-2,3-dihydroindole-1-carbothioyl)amino]-5-phenylthiophene-3-carboxylate (PubChem CID 3280591) has the molecular formula C23H22N2O2S2 and a molecular weight of 422.58 g/mol. Its IUPAC name is ethyl 2-[(2-methyl-2,3-dihydroindole-1-carbothioyl)amino]-5-phenylthiophene-3-carboxylate.
| Compound Name | ethyl 2-[(2-methyl-2,3-dihydroindole-1-carbothioyl)amino]-5-phenylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 3280591 |
| Molecular Formula | C23H22N2O2S2 |
| Molecular Weight | 422.58 g/mol |
| Exact Mass | 422.11 |
| IUPAC Name | ethyl 2-[(2-methyl-2,3-dihydroindole-1-carbothioyl)amino]-5-phenylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1cc(-c2ccccc2)sc1NC(=S)N1c2ccccc2CC1C |
| InChI | InChI=1S/C23H22N2O2S2/c1-3-27-22(26)18-14-20(16-9-5-4-6-10-16)29-21(18)24-23(28)25-15(2)13-17-11-7-8-12-19(17)25/h4-12,14-15H,3,13H2,1-2H3,(H,24,28) |
| InChIKey | IVSLYVGOMOBTLV-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.58 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|