C17H18N2O2S2 — CID 4509726
methyl 5-methyl-2-[(2-methyl-2,3-dihydroindole-1-carbothioyl)amino]thiophene-3-carboxylate (PubChem CID 4509726) has the molecular formula C17H18N2O2S2 and a molecular weight of 346.48 g/mol. Its IUPAC name is methyl 5-methyl-2-[(2-methyl-2,3-dihydroindole-1-carbothioyl)amino]thiophene-3-carboxylate.
| Compound Name | methyl 5-methyl-2-[(2-methyl-2,3-dihydroindole-1-carbothioyl)amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 4509726 |
| Molecular Formula | C17H18N2O2S2 |
| Molecular Weight | 346.48 g/mol |
| Exact Mass | 346.08 |
| IUPAC Name | methyl 5-methyl-2-[(2-methyl-2,3-dihydroindole-1-carbothioyl)amino]thiophene-3-carboxylate |
| SMILES | COC(=O)c1cc(C)sc1NC(=S)N1c2ccccc2CC1C |
| InChI | InChI=1S/C17H18N2O2S2/c1-10-8-12-6-4-5-7-14(12)19(10)17(22)18-15-13(16(20)21-3)9-11(2)23-15/h4-7,9-10H,8H2,1-3H3,(H,18,22) |
| InChIKey | OZKAVODXYZCKLP-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.48 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|