C15H22N2O2S2 — CID 40646186
methyl 2-[[(3R,5R)-3,5-dimethylpiperidine-1-carbothioyl]amino]-5-methylthiophene-3-carboxylate (PubChem CID 40646186) has the molecular formula C15H22N2O2S2 and a molecular weight of 326.49 g/mol. Its IUPAC name is methyl 2-[[(3R,5R)-3,5-dimethylpiperidine-1-carbothioyl]amino]-5-methylthiophene-3-carboxylate.
| Compound Name | methyl 2-[[(3R,5R)-3,5-dimethylpiperidine-1-carbothioyl]amino]-5-methylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 40646186 |
| Molecular Formula | C15H22N2O2S2 |
| Molecular Weight | 326.49 g/mol |
| Exact Mass | 326.11 |
| IUPAC Name | methyl 2-[[(3R,5R)-3,5-dimethylpiperidine-1-carbothioyl]amino]-5-methylthiophene-3-carboxylate |
| SMILES | COC(=O)c1cc(C)sc1NC(=S)N1C[C@H](C)C[C@@H](C)C1 |
| InChI | InChI=1S/C15H22N2O2S2/c1-9-5-10(2)8-17(7-9)15(20)16-13-12(14(18)19-4)6-11(3)21-13/h6,9-10H,5,7-8H2,1-4H3,(H,16,20)/t9-,10-/m1/s1 |
| InChIKey | DDFOBDSYMCJJSS-NXEZZACHSA-N |
| XLogP | 3.52 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.49 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|