C12H13Br2NO3S — CID 2166475
methyl 2-[[(1R)-2,2-dibromo-1-methylcyclopropanecarbonyl]amino]-5-methylthiophene-3-carboxylate (PubChem CID 2166475) has the molecular formula C12H13Br2NO3S and a molecular weight of 411.12 g/mol. Its IUPAC name is methyl 2-[[(1R)-2,2-dibromo-1-methylcyclopropanecarbonyl]amino]-5-methylthiophene-3-carboxylate.
| Compound Name | methyl 2-[[(1R)-2,2-dibromo-1-methylcyclopropanecarbonyl]amino]-5-methylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 2166475 |
| Molecular Formula | C12H13Br2NO3S |
| Molecular Weight | 411.12 g/mol |
| Exact Mass | 408.90 |
| IUPAC Name | methyl 2-[[(1R)-2,2-dibromo-1-methylcyclopropanecarbonyl]amino]-5-methylthiophene-3-carboxylate |
| SMILES | COC(=O)c1cc(C)sc1NC(=O)[C@@]1(C)CC1(Br)Br |
| InChI | InChI=1S/C12H13Br2NO3S/c1-6-4-7(9(16)18-3)8(19-6)15-10(17)11(2)5-12(11,13)14/h4H,5H2,1-3H3,(H,15,17)/t11-/m1/s1 |
| InChIKey | RHURXKNROIXSAY-LLVKDONJSA-N |
| XLogP | 3.68 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.12 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|