C18H17Cl2NO3S — CID 2167894
methyl 5-benzyl-2-[[(1S)-2,2-dichloro-1-methylcyclopropanecarbonyl]amino]thiophene-3-carboxylate (PubChem CID 2167894) has the molecular formula C18H17Cl2NO3S and a molecular weight of 398.31 g/mol. Its IUPAC name is methyl 5-benzyl-2-[[(1S)-2,2-dichloro-1-methylcyclopropanecarbonyl]amino]thiophene-3-carboxylate.
| Compound Name | methyl 5-benzyl-2-[[(1S)-2,2-dichloro-1-methylcyclopropanecarbonyl]amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 2167894 |
| Molecular Formula | C18H17Cl2NO3S |
| Molecular Weight | 398.31 g/mol |
| Exact Mass | 397.03 |
| IUPAC Name | methyl 5-benzyl-2-[[(1S)-2,2-dichloro-1-methylcyclopropanecarbonyl]amino]thiophene-3-carboxylate |
| SMILES | COC(=O)c1cc(Cc2ccccc2)sc1NC(=O)[C@]1(C)CC1(Cl)Cl |
| InChI | InChI=1S/C18H17Cl2NO3S/c1-17(10-18(17,19)20)16(23)21-14-13(15(22)24-2)9-12(25-14)8-11-6-4-3-5-7-11/h3-7,9H,8,10H2,1-2H3,(H,21,23)/t17-/m0/s1 |
| InChIKey | ZEPJOGSVSWKVRU-KRWDZBQOSA-N |
| XLogP | 4.65 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.31 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|