C22H21FN2O2S2 — CID 19649767
methyl 5-benzyl-2-[2-(4-fluorophenyl)ethylcarbamothioylamino]thiophene-3-carboxylate (PubChem CID 19649767) has the molecular formula C22H21FN2O2S2 and a molecular weight of 428.55 g/mol. Its IUPAC name is methyl 5-benzyl-2-[2-(4-fluorophenyl)ethylcarbamothioylamino]thiophene-3-carboxylate.
| Compound Name | methyl 5-benzyl-2-[2-(4-fluorophenyl)ethylcarbamothioylamino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 19649767 |
| Molecular Formula | C22H21FN2O2S2 |
| Molecular Weight | 428.55 g/mol |
| Exact Mass | 428.10 |
| IUPAC Name | methyl 5-benzyl-2-[2-(4-fluorophenyl)ethylcarbamothioylamino]thiophene-3-carboxylate |
| SMILES | COC(=O)c1cc(Cc2ccccc2)sc1NC(=S)NCCc1ccc(F)cc1 |
| InChI | InChI=1S/C22H21FN2O2S2/c1-27-21(26)19-14-18(13-16-5-3-2-4-6-16)29-20(19)25-22(28)24-12-11-15-7-9-17(23)10-8-15/h2-10,14H,11-13H2,1H3,(H2,24,25,28) |
| InChIKey | AWVHHDKRZNPKSO-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.55 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|