C25H28N2O2S2 — CID 19650205
ethyl 5-benzyl-2-(4-phenylbutylcarbamothioylamino)thiophene-3-carboxylate (PubChem CID 19650205) has the molecular formula C25H28N2O2S2 and a molecular weight of 452.65 g/mol. Its IUPAC name is ethyl 5-benzyl-2-(4-phenylbutylcarbamothioylamino)thiophene-3-carboxylate.
| Compound Name | ethyl 5-benzyl-2-(4-phenylbutylcarbamothioylamino)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 19650205 |
| Molecular Formula | C25H28N2O2S2 |
| Molecular Weight | 452.65 g/mol |
| Exact Mass | 452.16 |
| IUPAC Name | ethyl 5-benzyl-2-(4-phenylbutylcarbamothioylamino)thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1cc(Cc2ccccc2)sc1NC(=S)NCCCCc1ccccc1 |
| InChI | InChI=1S/C25H28N2O2S2/c1-2-29-24(28)22-18-21(17-20-14-7-4-8-15-20)31-23(22)27-25(30)26-16-10-9-13-19-11-5-3-6-12-19/h3-8,11-12,14-15,18H,2,9-10,13,16-17H2,1H3,(H2,26,27,30) |
| InChIKey | ZJNOOVMCOKKWND-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.65 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|