C35H48N2O3S2 — CID 19650384
ethyl 5-benzyl-2-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butylcarbamothioylamino]thiophene-3-carboxylate (PubChem CID 19650384) has the molecular formula C35H48N2O3S2 and a molecular weight of 608.91 g/mol. Its IUPAC name is ethyl 5-benzyl-2-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butylcarbamothioylamino]thiophene-3-carboxylate.
| Compound Name | ethyl 5-benzyl-2-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butylcarbamothioylamino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 19650384 |
| Molecular Formula | C35H48N2O3S2 |
| Molecular Weight | 608.91 g/mol |
| Exact Mass | 608.31 |
| IUPAC Name | ethyl 5-benzyl-2-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butylcarbamothioylamino]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1cc(Cc2ccccc2)sc1NC(=S)NCCCCOc1ccc(C(C)(C)CC)cc1C(C)(C)CC |
| InChI | InChI=1S/C35H48N2O3S2/c1-8-34(4,5)26-18-19-30(29(23-26)35(6,7)9-2)40-21-15-14-20-36-33(41)37-31-28(32(38)39-10-3)24-27(42-31)22-25-16-12-11-13-17-25/h11-13,16-19,23-24H,8-10,14-15,20-22H2,1-7H3,(H2,36,37,41) |
| InChIKey | BBDLEBIMRJCHGQ-UHFFFAOYSA-N |
| XLogP | 9.04 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.91 |
| LogP ≤ 5 | 9.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|