C23H23ClN2O4S2 — CID 19676081
ethyl 5-benzyl-2-[(5-chloro-2,4-dimethoxyphenyl)carbamothioylamino]thiophene-3-carboxylate (PubChem CID 19676081) has the molecular formula C23H23ClN2O4S2 and a molecular weight of 491.03 g/mol. Its IUPAC name is ethyl 5-benzyl-2-[(5-chloro-2,4-dimethoxyphenyl)carbamothioylamino]thiophene-3-carboxylate.
| Compound Name | ethyl 5-benzyl-2-[(5-chloro-2,4-dimethoxyphenyl)carbamothioylamino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 19676081 |
| Molecular Formula | C23H23ClN2O4S2 |
| Molecular Weight | 491.03 g/mol |
| Exact Mass | 490.08 |
| IUPAC Name | ethyl 5-benzyl-2-[(5-chloro-2,4-dimethoxyphenyl)carbamothioylamino]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1cc(Cc2ccccc2)sc1NC(=S)Nc1cc(Cl)c(OC)cc1OC |
| InChI | InChI=1S/C23H23ClN2O4S2/c1-4-30-22(27)16-11-15(10-14-8-6-5-7-9-14)32-21(16)26-23(31)25-18-12-17(24)19(28-2)13-20(18)29-3/h5-9,11-13H,4,10H2,1-3H3,(H2,25,26,31) |
| InChIKey | MCMZAQAVGUYYPN-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.03 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|