C23H23N3O3S2 — CID 19678512
ethyl 2-[(3-acetamidophenyl)carbamothioylamino]-5-benzylthiophene-3-carboxylate (PubChem CID 19678512) has the molecular formula C23H23N3O3S2 and a molecular weight of 453.59 g/mol. Its IUPAC name is ethyl 2-[(3-acetamidophenyl)carbamothioylamino]-5-benzylthiophene-3-carboxylate.
| Compound Name | ethyl 2-[(3-acetamidophenyl)carbamothioylamino]-5-benzylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 19678512 |
| Molecular Formula | C23H23N3O3S2 |
| Molecular Weight | 453.59 g/mol |
| Exact Mass | 453.12 |
| IUPAC Name | ethyl 2-[(3-acetamidophenyl)carbamothioylamino]-5-benzylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1cc(Cc2ccccc2)sc1NC(=S)Nc1cccc(NC(C)=O)c1 |
| InChI | InChI=1S/C23H23N3O3S2/c1-3-29-22(28)20-14-19(12-16-8-5-4-6-9-16)31-21(20)26-23(30)25-18-11-7-10-17(13-18)24-15(2)27/h4-11,13-14H,3,12H2,1-2H3,(H,24,27)(H2,25,26,30) |
| InChIKey | PIIVWZNWAXWPCZ-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.59 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|