C20H18BrN3O4S2 — CID 3470418
ethyl 5-benzyl-2-[[(5-bromofuran-2-carbonyl)amino]carbamothioylamino]thiophene-3-carboxylate (PubChem CID 3470418) has the molecular formula C20H18BrN3O4S2 and a molecular weight of 508.42 g/mol. Its IUPAC name is ethyl 5-benzyl-2-[[(5-bromofuran-2-carbonyl)amino]carbamothioylamino]thiophene-3-carboxylate.
| Compound Name | ethyl 5-benzyl-2-[[(5-bromofuran-2-carbonyl)amino]carbamothioylamino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 3470418 |
| Molecular Formula | C20H18BrN3O4S2 |
| Molecular Weight | 508.42 g/mol |
| Exact Mass | 506.99 |
| IUPAC Name | ethyl 5-benzyl-2-[[(5-bromofuran-2-carbonyl)amino]carbamothioylamino]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1cc(Cc2ccccc2)sc1NC(=S)NNC(=O)c1ccc(Br)o1 |
| InChI | InChI=1S/C20H18BrN3O4S2/c1-2-27-19(26)14-11-13(10-12-6-4-3-5-7-12)30-18(14)22-20(29)24-23-17(25)15-8-9-16(21)28-15/h3-9,11H,2,10H2,1H3,(H,23,25)(H2,22,24,29) |
| InChIKey | SXFWFSREAORYRK-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 92.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.42 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|