C23H23NO4S — CID 46094993
ethyl 5-benzyl-2-[(2-phenylmethoxyacetyl)amino]thiophene-3-carboxylate (PubChem CID 46094993) has the molecular formula C23H23NO4S and a molecular weight of 409.51 g/mol. Its IUPAC name is ethyl 5-benzyl-2-[(2-phenylmethoxyacetyl)amino]thiophene-3-carboxylate.
| Compound Name | ethyl 5-benzyl-2-[(2-phenylmethoxyacetyl)amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 46094993 |
| Molecular Formula | C23H23NO4S |
| Molecular Weight | 409.51 g/mol |
| Exact Mass | 409.13 |
| IUPAC Name | ethyl 5-benzyl-2-[(2-phenylmethoxyacetyl)amino]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1cc(Cc2ccccc2)sc1NC(=O)COCc1ccccc1 |
| InChI | InChI=1S/C23H23NO4S/c1-2-28-23(26)20-14-19(13-17-9-5-3-6-10-17)29-22(20)24-21(25)16-27-15-18-11-7-4-8-12-18/h3-12,14H,2,13,15-16H2,1H3,(H,24,25) |
| InChIKey | RTXUXQJYOOKOTO-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.51 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |