C25H27NO3S — CID 46094725
ethyl 5-benzyl-2-[(4-tert-butylbenzoyl)amino]thiophene-3-carboxylate (PubChem CID 46094725) has the molecular formula C25H27NO3S and a molecular weight of 421.56 g/mol. Its IUPAC name is ethyl 5-benzyl-2-[(4-tert-butylbenzoyl)amino]thiophene-3-carboxylate.
| Compound Name | ethyl 5-benzyl-2-[(4-tert-butylbenzoyl)amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 46094725 |
| Molecular Formula | C25H27NO3S |
| Molecular Weight | 421.56 g/mol |
| Exact Mass | 421.17 |
| IUPAC Name | ethyl 5-benzyl-2-[(4-tert-butylbenzoyl)amino]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1cc(Cc2ccccc2)sc1NC(=O)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C25H27NO3S/c1-5-29-24(28)21-16-20(15-17-9-7-6-8-10-17)30-23(21)26-22(27)18-11-13-19(14-12-18)25(2,3)4/h6-14,16H,5,15H2,1-4H3,(H,26,27) |
| InChIKey | CRXGABPQBPMHMX-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.56 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |