C22H29NO3S — CID 19221299
ethyl 2-[3-(4-tert-butylphenyl)propanoylamino]-5-ethylthiophene-3-carboxylate (PubChem CID 19221299) has the molecular formula C22H29NO3S and a molecular weight of 387.55 g/mol. Its IUPAC name is ethyl 2-[3-(4-tert-butylphenyl)propanoylamino]-5-ethylthiophene-3-carboxylate.
| Compound Name | ethyl 2-[3-(4-tert-butylphenyl)propanoylamino]-5-ethylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 19221299 |
| Molecular Formula | C22H29NO3S |
| Molecular Weight | 387.55 g/mol |
| Exact Mass | 387.19 |
| IUPAC Name | ethyl 2-[3-(4-tert-butylphenyl)propanoylamino]-5-ethylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1cc(CC)sc1NC(=O)CCc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C22H29NO3S/c1-6-17-14-18(21(25)26-7-2)20(27-17)23-19(24)13-10-15-8-11-16(12-9-15)22(3,4)5/h8-9,11-12,14H,6-7,10,13H2,1-5H3,(H,23,24) |
| InChIKey | LLGWWDLRZFLJCL-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.55 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |