C15H23NO3S — CID 114875722
ethyl 5-ethyl-2-(3-methylpentanoylamino)thiophene-3-carboxylate (PubChem CID 114875722) has the molecular formula C15H23NO3S and a molecular weight of 297.42 g/mol. Its IUPAC name is ethyl 5-ethyl-2-(3-methylpentanoylamino)thiophene-3-carboxylate.
| Compound Name | ethyl 5-ethyl-2-(3-methylpentanoylamino)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 114875722 |
| Molecular Formula | C15H23NO3S |
| Molecular Weight | 297.42 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | ethyl 5-ethyl-2-(3-methylpentanoylamino)thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1cc(CC)sc1NC(=O)CC(C)CC |
| InChI | InChI=1S/C15H23NO3S/c1-5-10(4)8-13(17)16-14-12(15(18)19-7-3)9-11(6-2)20-14/h9-10H,5-8H2,1-4H3,(H,16,17) |
| InChIKey | LGMPMYHBPURDAW-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.42 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |