C14H21NO3S — CID 43409835
ethyl 5-ethyl-2-(2-methylbutanoylamino)thiophene-3-carboxylate (PubChem CID 43409835) has the molecular formula C14H21NO3S and a molecular weight of 283.39 g/mol. Its IUPAC name is ethyl 5-ethyl-2-(2-methylbutanoylamino)thiophene-3-carboxylate.
| Compound Name | ethyl 5-ethyl-2-(2-methylbutanoylamino)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 43409835 |
| Molecular Formula | C14H21NO3S |
| Molecular Weight | 283.39 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | ethyl 5-ethyl-2-(2-methylbutanoylamino)thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1cc(CC)sc1NC(=O)C(C)CC |
| InChI | InChI=1S/C14H21NO3S/c1-5-9(4)12(16)15-13-11(14(17)18-7-3)8-10(6-2)19-13/h8-9H,5-7H2,1-4H3,(H,15,16) |
| InChIKey | BPDCTTQHOLGADQ-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.39 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |