C23H32N2O2S2 — CID 19653269
ethyl 5-benzyl-2-[bis(2-methylpropyl)carbamothioylamino]thiophene-3-carboxylate (PubChem CID 19653269) has the molecular formula C23H32N2O2S2 and a molecular weight of 432.66 g/mol. Its IUPAC name is ethyl 5-benzyl-2-[bis(2-methylpropyl)carbamothioylamino]thiophene-3-carboxylate.
| Compound Name | ethyl 5-benzyl-2-[bis(2-methylpropyl)carbamothioylamino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 19653269 |
| Molecular Formula | C23H32N2O2S2 |
| Molecular Weight | 432.66 g/mol |
| Exact Mass | 432.19 |
| IUPAC Name | ethyl 5-benzyl-2-[bis(2-methylpropyl)carbamothioylamino]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1cc(Cc2ccccc2)sc1NC(=S)N(CC(C)C)CC(C)C |
| InChI | InChI=1S/C23H32N2O2S2/c1-6-27-22(26)20-13-19(12-18-10-8-7-9-11-18)29-21(20)24-23(28)25(14-16(2)3)15-17(4)5/h7-11,13,16-17H,6,12,14-15H2,1-5H3,(H,24,28) |
| InChIKey | IRZGNZLFRQQHAZ-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.66 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|