C25H36N2O2S2 — CID 19653352
ethyl 5-benzyl-2-(dipentylcarbamothioylamino)thiophene-3-carboxylate (PubChem CID 19653352) has the molecular formula C25H36N2O2S2 and a molecular weight of 460.71 g/mol. Its IUPAC name is ethyl 5-benzyl-2-(dipentylcarbamothioylamino)thiophene-3-carboxylate.
| Compound Name | ethyl 5-benzyl-2-(dipentylcarbamothioylamino)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 19653352 |
| Molecular Formula | C25H36N2O2S2 |
| Molecular Weight | 460.71 g/mol |
| Exact Mass | 460.22 |
| IUPAC Name | ethyl 5-benzyl-2-(dipentylcarbamothioylamino)thiophene-3-carboxylate |
| SMILES | CCCCCN(CCCCC)C(=S)Nc1sc(Cc2ccccc2)cc1C(=O)OCC |
| InChI | InChI=1S/C25H36N2O2S2/c1-4-7-12-16-27(17-13-8-5-2)25(30)26-23-22(24(28)29-6-3)19-21(31-23)18-20-14-10-9-11-15-20/h9-11,14-15,19H,4-8,12-13,16-18H2,1-3H3,(H,26,30) |
| InChIKey | VQUKMUYNYVIZIO-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.71 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|