C22H28N2O2S2 — CID 27525286
ethyl 5-benzyl-2-[[(2S,6R)-2,6-dimethylpiperidine-1-carbothioyl]amino]thiophene-3-carboxylate (PubChem CID 27525286) has the molecular formula C22H28N2O2S2 and a molecular weight of 416.61 g/mol. Its IUPAC name is ethyl 5-benzyl-2-[[(2S,6R)-2,6-dimethylpiperidine-1-carbothioyl]amino]thiophene-3-carboxylate.
| Compound Name | ethyl 5-benzyl-2-[[(2S,6R)-2,6-dimethylpiperidine-1-carbothioyl]amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 27525286 |
| Molecular Formula | C22H28N2O2S2 |
| Molecular Weight | 416.61 g/mol |
| Exact Mass | 416.16 |
| IUPAC Name | ethyl 5-benzyl-2-[[(2S,6R)-2,6-dimethylpiperidine-1-carbothioyl]amino]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1cc(Cc2ccccc2)sc1NC(=S)N1[C@H](C)CCC[C@@H]1C |
| InChI | InChI=1S/C22H28N2O2S2/c1-4-26-21(25)19-14-18(13-17-11-6-5-7-12-17)28-20(19)23-22(27)24-15(2)9-8-10-16(24)3/h5-7,11-12,14-16H,4,8-10,13H2,1-3H3,(H,23,27)/t15-,16+ |
| InChIKey | OAGZTFATAVSZEH-IYBDPMFKSA-N |
| XLogP | 5.48 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.61 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|