C20H24N2O2S2 — CID 40595730
methyl 2-[[(2R,6R)-2,6-dimethylpiperidine-1-carbothioyl]amino]-5-phenylthiophene-3-carboxylate (PubChem CID 40595730) has the molecular formula C20H24N2O2S2 and a molecular weight of 388.56 g/mol. Its IUPAC name is methyl 2-[[(2R,6R)-2,6-dimethylpiperidine-1-carbothioyl]amino]-5-phenylthiophene-3-carboxylate.
| Compound Name | methyl 2-[[(2R,6R)-2,6-dimethylpiperidine-1-carbothioyl]amino]-5-phenylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 40595730 |
| Molecular Formula | C20H24N2O2S2 |
| Molecular Weight | 388.56 g/mol |
| Exact Mass | 388.13 |
| IUPAC Name | methyl 2-[[(2R,6R)-2,6-dimethylpiperidine-1-carbothioyl]amino]-5-phenylthiophene-3-carboxylate |
| SMILES | COC(=O)c1cc(-c2ccccc2)sc1NC(=S)N1[C@H](C)CCC[C@H]1C |
| InChI | InChI=1S/C20H24N2O2S2/c1-13-8-7-9-14(2)22(13)20(25)21-18-16(19(23)24-3)12-17(26-18)15-10-5-4-6-11-15/h4-6,10-14H,7-9H2,1-3H3,(H,21,25)/t13-,14-/m1/s1 |
| InChIKey | YDWRILHQRGVLMC-ZIAGYGMSSA-N |
| XLogP | 5.16 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.56 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|