C18H20N2O3S2 — CID 40588420
methyl 2-[[(2R)-oxolan-2-yl]methylcarbamothioylamino]-5-phenylthiophene-3-carboxylate (PubChem CID 40588420) has the molecular formula C18H20N2O3S2 and a molecular weight of 376.50 g/mol. Its IUPAC name is methyl 2-[[(2R)-oxolan-2-yl]methylcarbamothioylamino]-5-phenylthiophene-3-carboxylate.
| Compound Name | methyl 2-[[(2R)-oxolan-2-yl]methylcarbamothioylamino]-5-phenylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 40588420 |
| Molecular Formula | C18H20N2O3S2 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.09 |
| IUPAC Name | methyl 2-[[(2R)-oxolan-2-yl]methylcarbamothioylamino]-5-phenylthiophene-3-carboxylate |
| SMILES | COC(=O)c1cc(-c2ccccc2)sc1NC(=S)NC[C@H]1CCCO1 |
| InChI | InChI=1S/C18H20N2O3S2/c1-22-17(21)14-10-15(12-6-3-2-4-7-12)25-16(14)20-18(24)19-11-13-8-5-9-23-13/h2-4,6-7,10,13H,5,8-9,11H2,1H3,(H2,19,20,24)/t13-/m1/s1 |
| InChIKey | KSQTVANCTCQZJT-CYBMUJFWSA-N |
| XLogP | 3.67 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|