C13H16N2O3S — CID 1133426
4-[[(2R)-oxolan-2-yl]methylcarbamothioylamino]benzoic acid (PubChem CID 1133426) has the molecular formula C13H16N2O3S and a molecular weight of 280.35 g/mol. Its IUPAC name is 4-[[(2R)-oxolan-2-yl]methylcarbamothioylamino]benzoic acid.
| Compound Name | 4-[[(2R)-oxolan-2-yl]methylcarbamothioylamino]benzoic acid |
|---|---|
| PubChem CID | 1133426 |
| Molecular Formula | C13H16N2O3S |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | 4-[[(2R)-oxolan-2-yl]methylcarbamothioylamino]benzoic acid |
| SMILES | O=C(O)c1ccc(NC(=S)NC[C@H]2CCCO2)cc1 |
| InChI | InChI=1S/C13H16N2O3S/c16-12(17)9-3-5-10(6-4-9)15-13(19)14-8-11-2-1-7-18-11/h3-6,11H,1-2,7-8H2,(H,16,17)(H2,14,15,19)/t11-/m1/s1 |
| InChIKey | PPPKKEKYHHWGLU-LLVKDONJSA-N |
| XLogP | 1.85 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|