C13H18N4O2S — CID 51455340
1-[[(2R)-oxolan-2-yl]methylcarbamothioylamino]-3-phenylurea (PubChem CID 51455340) has the molecular formula C13H18N4O2S and a molecular weight of 294.38 g/mol. Its IUPAC name is 1-[[(2R)-oxolan-2-yl]methylcarbamothioylamino]-3-phenylurea.
| Compound Name | 1-[[(2R)-oxolan-2-yl]methylcarbamothioylamino]-3-phenylurea |
|---|---|
| PubChem CID | 51455340 |
| Molecular Formula | C13H18N4O2S |
| Molecular Weight | 294.38 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | 1-[[(2R)-oxolan-2-yl]methylcarbamothioylamino]-3-phenylurea |
| SMILES | O=C(NNC(=S)NC[C@H]1CCCO1)Nc1ccccc1 |
| InChI | InChI=1S/C13H18N4O2S/c18-12(15-10-5-2-1-3-6-10)16-17-13(20)14-9-11-7-4-8-19-11/h1-3,5-6,11H,4,7-9H2,(H2,14,17,20)(H2,15,16,18)/t11-/m1/s1 |
| InChIKey | BMLUQGZGKXEZNG-LLVKDONJSA-N |
| XLogP | 1.37 |
| TPSA | 74.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.38 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|