C14H20N4OS2 — CID 2448710
1-benzyl-3-[[(2S)-oxolan-2-yl]methylcarbamothioylamino]thiourea (PubChem CID 2448710) has the molecular formula C14H20N4OS2 and a molecular weight of 324.47 g/mol. Its IUPAC name is 1-benzyl-3-[[(2S)-oxolan-2-yl]methylcarbamothioylamino]thiourea.
| Compound Name | 1-benzyl-3-[[(2S)-oxolan-2-yl]methylcarbamothioylamino]thiourea |
|---|---|
| PubChem CID | 2448710 |
| Molecular Formula | C14H20N4OS2 |
| Molecular Weight | 324.47 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | 1-benzyl-3-[[(2S)-oxolan-2-yl]methylcarbamothioylamino]thiourea |
| SMILES | S=C(NCc1ccccc1)NNC(=S)NC[C@@H]1CCCO1 |
| InChI | InChI=1S/C14H20N4OS2/c20-13(15-9-11-5-2-1-3-6-11)17-18-14(21)16-10-12-7-4-8-19-12/h1-3,5-6,12H,4,7-10H2,(H2,15,17,20)(H2,16,18,21)/t12-/m0/s1 |
| InChIKey | FSNHURGACNEDFW-LBPRGKRZSA-N |
| XLogP | 1.21 |
| TPSA | 57.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.47 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|