C21H26N2O2S — CID 43077068
1-(oxolan-2-ylmethyl)-3-[[4-(phenylmethoxymethyl)phenyl]methyl]thiourea (PubChem CID 43077068) has the molecular formula C21H26N2O2S and a molecular weight of 370.52 g/mol. Its IUPAC name is 1-(oxolan-2-ylmethyl)-3-[[4-(phenylmethoxymethyl)phenyl]methyl]thiourea.
| Compound Name | 1-(oxolan-2-ylmethyl)-3-[[4-(phenylmethoxymethyl)phenyl]methyl]thiourea |
|---|---|
| PubChem CID | 43077068 |
| Molecular Formula | C21H26N2O2S |
| Molecular Weight | 370.52 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | 1-(oxolan-2-ylmethyl)-3-[[4-(phenylmethoxymethyl)phenyl]methyl]thiourea |
| SMILES | S=C(NCc1ccc(COCc2ccccc2)cc1)NCC1CCCO1 |
| InChI | InChI=1S/C21H26N2O2S/c26-21(23-14-20-7-4-12-25-20)22-13-17-8-10-19(11-9-17)16-24-15-18-5-2-1-3-6-18/h1-3,5-6,8-11,20H,4,7,12-16H2,(H2,22,23,26) |
| InChIKey | AYCLHJVDBMDHTB-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.52 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|