C11H16N2O2S — CID 972556
1-(furan-2-ylmethyl)-3-[[(2S)-oxolan-2-yl]methyl]thiourea (PubChem CID 972556) has the molecular formula C11H16N2O2S and a molecular weight of 240.33 g/mol. Its IUPAC name is 1-(furan-2-ylmethyl)-3-[[(2S)-oxolan-2-yl]methyl]thiourea.
| Compound Name | 1-(furan-2-ylmethyl)-3-[[(2S)-oxolan-2-yl]methyl]thiourea |
|---|---|
| PubChem CID | 972556 |
| Molecular Formula | C11H16N2O2S |
| Molecular Weight | 240.33 g/mol |
| Exact Mass | 240.09 |
| IUPAC Name | 1-(furan-2-ylmethyl)-3-[[(2S)-oxolan-2-yl]methyl]thiourea |
| SMILES | S=C(NCc1ccco1)NC[C@@H]1CCCO1 |
| InChI | InChI=1S/C11H16N2O2S/c16-11(12-7-9-3-1-5-14-9)13-8-10-4-2-6-15-10/h1,3,5,10H,2,4,6-8H2,(H2,12,13,16)/t10-/m0/s1 |
| InChIKey | JGEIDGRFUMKSQQ-JTQLQIEISA-N |
| XLogP | 1.42 |
| TPSA | 46.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.33 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|