C11H20N2O2S — CID 19653607
1,3-bis(oxolan-2-ylmethyl)thiourea (PubChem CID 19653607) has the molecular formula C11H20N2O2S and a molecular weight of 244.36 g/mol. Its IUPAC name is 1,3-bis(oxolan-2-ylmethyl)thiourea.
| Compound Name | 1,3-bis(oxolan-2-ylmethyl)thiourea |
|---|---|
| PubChem CID | 19653607 |
| Molecular Formula | C11H20N2O2S |
| Molecular Weight | 244.36 g/mol |
| Exact Mass | 244.12 |
| IUPAC Name | 1,3-bis(oxolan-2-ylmethyl)thiourea |
| SMILES | S=C(NCC1CCCO1)NCC1CCCO1 |
| InChI | InChI=1S/C11H20N2O2S/c16-11(12-7-9-3-1-5-14-9)13-8-10-4-2-6-15-10/h9-10H,1-8H2,(H2,12,13,16) |
| InChIKey | JPJSDZGQOUMOHJ-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.36 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|