C8H15N3O3S — CID 17373236
methyl N-(oxolan-2-ylmethylcarbamothioylamino)carbamate (PubChem CID 17373236) has the molecular formula C8H15N3O3S and a molecular weight of 233.29 g/mol. Its IUPAC name is methyl N-(oxolan-2-ylmethylcarbamothioylamino)carbamate.
| Compound Name | methyl N-(oxolan-2-ylmethylcarbamothioylamino)carbamate |
|---|---|
| PubChem CID | 17373236 |
| Molecular Formula | C8H15N3O3S |
| Molecular Weight | 233.29 g/mol |
| Exact Mass | 233.08 |
| IUPAC Name | methyl N-(oxolan-2-ylmethylcarbamothioylamino)carbamate |
| SMILES | COC(=O)NNC(=S)NCC1CCCO1 |
| InChI | InChI=1S/C8H15N3O3S/c1-13-8(12)11-10-7(15)9-5-6-3-2-4-14-6/h6H,2-5H2,1H3,(H,11,12)(H2,9,10,15) |
| InChIKey | MCAMMAUNBFDDFP-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 71.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.29 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|