C14H18ClN3O3S — CID 17373498
1-[(5-chloro-2-methoxybenzoyl)amino]-3-(oxolan-2-ylmethyl)thiourea (PubChem CID 17373498) has the molecular formula C14H18ClN3O3S and a molecular weight of 343.84 g/mol. Its IUPAC name is 1-[(5-chloro-2-methoxybenzoyl)amino]-3-(oxolan-2-ylmethyl)thiourea.
| Compound Name | 1-[(5-chloro-2-methoxybenzoyl)amino]-3-(oxolan-2-ylmethyl)thiourea |
|---|---|
| PubChem CID | 17373498 |
| Molecular Formula | C14H18ClN3O3S |
| Molecular Weight | 343.84 g/mol |
| Exact Mass | 343.08 |
| IUPAC Name | 1-[(5-chloro-2-methoxybenzoyl)amino]-3-(oxolan-2-ylmethyl)thiourea |
| SMILES | COc1ccc(Cl)cc1C(=O)NNC(=S)NCC1CCCO1 |
| InChI | InChI=1S/C14H18ClN3O3S/c1-20-12-5-4-9(15)7-11(12)13(19)17-18-14(22)16-8-10-3-2-6-21-10/h4-5,7,10H,2-3,6,8H2,1H3,(H,17,19)(H2,16,18,22) |
| InChIKey | SUWJIZMCSHFBAF-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 71.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.84 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|