C17H19ClN4O4S2 — CID 44956752
5-chloro-2-methoxy-N-[5-[2-oxo-2-(oxolan-2-ylmethylamino)ethyl]sulfanyl-1,3,4-thiadiazol-2-yl]benzamide (PubChem CID 44956752) has the molecular formula C17H19ClN4O4S2 and a molecular weight of 442.95 g/mol. Its IUPAC name is 5-chloro-2-methoxy-N-[5-[2-oxo-2-(oxolan-2-ylmethylamino)ethyl]sulfanyl-1,3,4-thiadiazol-2-yl]benzamide.
| Compound Name | 5-chloro-2-methoxy-N-[5-[2-oxo-2-(oxolan-2-ylmethylamino)ethyl]sulfanyl-1,3,4-thiadiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 44956752 |
| Molecular Formula | C17H19ClN4O4S2 |
| Molecular Weight | 442.95 g/mol |
| Exact Mass | 442.05 |
| IUPAC Name | 5-chloro-2-methoxy-N-[5-[2-oxo-2-(oxolan-2-ylmethylamino)ethyl]sulfanyl-1,3,4-thiadiazol-2-yl]benzamide |
| SMILES | COc1ccc(Cl)cc1C(=O)Nc1nnc(SCC(=O)NCC2CCCO2)s1 |
| InChI | InChI=1S/C17H19ClN4O4S2/c1-25-13-5-4-10(18)7-12(13)15(24)20-16-21-22-17(28-16)27-9-14(23)19-8-11-3-2-6-26-11/h4-5,7,11H,2-3,6,8-9H2,1H3,(H,19,23)(H,20,21,24) |
| InChIKey | KZNFYQYAXOIURL-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 102.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.95 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|