C16H19N5O4S2 — CID 121030062
5-cyclopropyl-N-[5-[2-oxo-2-(oxolan-2-ylmethylamino)ethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-1,2-oxazole-3-carboxamide (PubChem CID 121030062) has the molecular formula C16H19N5O4S2 and a molecular weight of 409.49 g/mol. Its IUPAC name is 5-cyclopropyl-N-[5-[2-oxo-2-(oxolan-2-ylmethylamino)ethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-1,2-oxazole-3-carboxamide.
| Compound Name | 5-cyclopropyl-N-[5-[2-oxo-2-(oxolan-2-ylmethylamino)ethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 121030062 |
| Molecular Formula | C16H19N5O4S2 |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.09 |
| IUPAC Name | 5-cyclopropyl-N-[5-[2-oxo-2-(oxolan-2-ylmethylamino)ethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-1,2-oxazole-3-carboxamide |
| SMILES | O=C(CSc1nnc(NC(=O)c2cc(C3CC3)on2)s1)NCC1CCCO1 |
| InChI | InChI=1S/C16H19N5O4S2/c22-13(17-7-10-2-1-5-24-10)8-26-16-20-19-15(27-16)18-14(23)11-6-12(25-21-11)9-3-4-9/h6,9-10H,1-5,7-8H2,(H,17,22)(H,18,19,23) |
| InChIKey | SJRBZBRTKVGCBY-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 119.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|