C18H16ClN5O3S2 — CID 121030060
N-[5-[2-[(2-chlorophenyl)methylamino]-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-5-cyclopropyl-1,2-oxazole-3-carboxamide (PubChem CID 121030060) has the molecular formula C18H16ClN5O3S2 and a molecular weight of 449.95 g/mol. Its IUPAC name is N-[5-[2-[(2-chlorophenyl)methylamino]-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-5-cyclopropyl-1,2-oxazole-3-carboxamide.
| Compound Name | N-[5-[2-[(2-chlorophenyl)methylamino]-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-5-cyclopropyl-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 121030060 |
| Molecular Formula | C18H16ClN5O3S2 |
| Molecular Weight | 449.95 g/mol |
| Exact Mass | 449.04 |
| IUPAC Name | N-[5-[2-[(2-chlorophenyl)methylamino]-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-5-cyclopropyl-1,2-oxazole-3-carboxamide |
| SMILES | O=C(CSc1nnc(NC(=O)c2cc(C3CC3)on2)s1)NCc1ccccc1Cl |
| InChI | InChI=1S/C18H16ClN5O3S2/c19-12-4-2-1-3-11(12)8-20-15(25)9-28-18-23-22-17(29-18)21-16(26)13-7-14(27-24-13)10-5-6-10/h1-4,7,10H,5-6,8-9H2,(H,20,25)(H,21,22,26) |
| InChIKey | OPPFSIODJRLHJD-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 110.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.95 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|