C18H14F3N5O3S2 — CID 121030042
5-cyclopropyl-N-[5-[2-oxo-2-[3-(trifluoromethyl)anilino]ethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-1,2-oxazole-3-carboxamide (PubChem CID 121030042) has the molecular formula C18H14F3N5O3S2 and a molecular weight of 469.47 g/mol. Its IUPAC name is 5-cyclopropyl-N-[5-[2-oxo-2-[3-(trifluoromethyl)anilino]ethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-1,2-oxazole-3-carboxamide.
| Compound Name | 5-cyclopropyl-N-[5-[2-oxo-2-[3-(trifluoromethyl)anilino]ethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 121030042 |
| Molecular Formula | C18H14F3N5O3S2 |
| Molecular Weight | 469.47 g/mol |
| Exact Mass | 469.05 |
| IUPAC Name | 5-cyclopropyl-N-[5-[2-oxo-2-[3-(trifluoromethyl)anilino]ethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-1,2-oxazole-3-carboxamide |
| SMILES | O=C(CSc1nnc(NC(=O)c2cc(C3CC3)on2)s1)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H14F3N5O3S2/c19-18(20,21)10-2-1-3-11(6-10)22-14(27)8-30-17-25-24-16(31-17)23-15(28)12-7-13(29-26-12)9-4-5-9/h1-3,6-7,9H,4-5,8H2,(H,22,27)(H,23,24,28) |
| InChIKey | ULXGHIIFARAYMC-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 110.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.47 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|