C19H15F3N4O2S2 — CID 18561267
4-methyl-N-[5-[2-oxo-2-[3-(trifluoromethyl)anilino]ethyl]sulfanyl-1,3,4-thiadiazol-2-yl]benzamide (PubChem CID 18561267) has the molecular formula C19H15F3N4O2S2 and a molecular weight of 452.48 g/mol. Its IUPAC name is 4-methyl-N-[5-[2-oxo-2-[3-(trifluoromethyl)anilino]ethyl]sulfanyl-1,3,4-thiadiazol-2-yl]benzamide.
| Compound Name | 4-methyl-N-[5-[2-oxo-2-[3-(trifluoromethyl)anilino]ethyl]sulfanyl-1,3,4-thiadiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 18561267 |
| Molecular Formula | C19H15F3N4O2S2 |
| Molecular Weight | 452.48 g/mol |
| Exact Mass | 452.06 |
| IUPAC Name | 4-methyl-N-[5-[2-oxo-2-[3-(trifluoromethyl)anilino]ethyl]sulfanyl-1,3,4-thiadiazol-2-yl]benzamide |
| SMILES | Cc1ccc(C(=O)Nc2nnc(SCC(=O)Nc3cccc(C(F)(F)F)c3)s2)cc1 |
| InChI | InChI=1S/C19H15F3N4O2S2/c1-11-5-7-12(8-6-11)16(28)24-17-25-26-18(30-17)29-10-15(27)23-14-4-2-3-13(9-14)19(20,21)22/h2-9H,10H2,1H3,(H,23,27)(H,24,25,28) |
| InChIKey | MRKFXYHEBSUQFY-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.48 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|