C21H21N5O3S2 — CID 40833665
N-[5-[2-(3-acetamidoanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-3,4-dimethylbenzamide (PubChem CID 40833665) has the molecular formula C21H21N5O3S2 and a molecular weight of 455.57 g/mol. Its IUPAC name is N-[5-[2-(3-acetamidoanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-3,4-dimethylbenzamide.
| Compound Name | N-[5-[2-(3-acetamidoanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-3,4-dimethylbenzamide |
|---|---|
| PubChem CID | 40833665 |
| Molecular Formula | C21H21N5O3S2 |
| Molecular Weight | 455.57 g/mol |
| Exact Mass | 455.11 |
| IUPAC Name | N-[5-[2-(3-acetamidoanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-3,4-dimethylbenzamide |
| SMILES | CC(=O)Nc1cccc(NC(=O)CSc2nnc(NC(=O)c3ccc(C)c(C)c3)s2)c1 |
| InChI | InChI=1S/C21H21N5O3S2/c1-12-7-8-15(9-13(12)2)19(29)24-20-25-26-21(31-20)30-11-18(28)23-17-6-4-5-16(10-17)22-14(3)27/h4-10H,11H2,1-3H3,(H,22,27)(H,23,28)(H,24,25,29) |
| InChIKey | WPORAEQYGYZVEZ-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 113.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.57 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|