C23H19N5O3S2 — CID 40832843
N-[5-[2-(4-acetamidoanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]naphthalene-2-carboxamide (PubChem CID 40832843) has the molecular formula C23H19N5O3S2 and a molecular weight of 477.57 g/mol. Its IUPAC name is N-[5-[2-(4-acetamidoanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]naphthalene-2-carboxamide.
| Compound Name | N-[5-[2-(4-acetamidoanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 40832843 |
| Molecular Formula | C23H19N5O3S2 |
| Molecular Weight | 477.57 g/mol |
| Exact Mass | 477.09 |
| IUPAC Name | N-[5-[2-(4-acetamidoanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]naphthalene-2-carboxamide |
| SMILES | CC(=O)Nc1ccc(NC(=O)CSc2nnc(NC(=O)c3ccc4ccccc4c3)s2)cc1 |
| InChI | InChI=1S/C23H19N5O3S2/c1-14(29)24-18-8-10-19(11-9-18)25-20(30)13-32-23-28-27-22(33-23)26-21(31)17-7-6-15-4-2-3-5-16(15)12-17/h2-12H,13H2,1H3,(H,24,29)(H,25,30)(H,26,27,31) |
| InChIKey | IGFGUXRVOXXLAY-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 113.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.57 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|