C23H25N5O3S2 — CID 42448183
N-[5-[2-(3-acetamidoanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-4-tert-butylbenzamide (PubChem CID 42448183) has the molecular formula C23H25N5O3S2 and a molecular weight of 483.62 g/mol. Its IUPAC name is N-[5-[2-(3-acetamidoanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-4-tert-butylbenzamide.
| Compound Name | N-[5-[2-(3-acetamidoanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-4-tert-butylbenzamide |
|---|---|
| PubChem CID | 42448183 |
| Molecular Formula | C23H25N5O3S2 |
| Molecular Weight | 483.62 g/mol |
| Exact Mass | 483.14 |
| IUPAC Name | N-[5-[2-(3-acetamidoanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-4-tert-butylbenzamide |
| SMILES | CC(=O)Nc1cccc(NC(=O)CSc2nnc(NC(=O)c3ccc(C(C)(C)C)cc3)s2)c1 |
| InChI | InChI=1S/C23H25N5O3S2/c1-14(29)24-17-6-5-7-18(12-17)25-19(30)13-32-22-28-27-21(33-22)26-20(31)15-8-10-16(11-9-15)23(2,3)4/h5-12H,13H2,1-4H3,(H,24,29)(H,25,30)(H,26,27,31) |
| InChIKey | NSQIAHSSPAIXOT-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 113.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.62 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|