C23H25N5O5S2 — CID 40833777
N-[5-[2-(4-acetamidoanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-3,4-diethoxybenzamide (PubChem CID 40833777) has the molecular formula C23H25N5O5S2 and a molecular weight of 515.62 g/mol. Its IUPAC name is N-[5-[2-(4-acetamidoanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-3,4-diethoxybenzamide.
| Compound Name | N-[5-[2-(4-acetamidoanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-3,4-diethoxybenzamide |
|---|---|
| PubChem CID | 40833777 |
| Molecular Formula | C23H25N5O5S2 |
| Molecular Weight | 515.62 g/mol |
| Exact Mass | 515.13 |
| IUPAC Name | N-[5-[2-(4-acetamidoanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-3,4-diethoxybenzamide |
| SMILES | CCOc1ccc(C(=O)Nc2nnc(SCC(=O)Nc3ccc(NC(C)=O)cc3)s2)cc1OCC |
| InChI | InChI=1S/C23H25N5O5S2/c1-4-32-18-11-6-15(12-19(18)33-5-2)21(31)26-22-27-28-23(35-22)34-13-20(30)25-17-9-7-16(8-10-17)24-14(3)29/h6-12H,4-5,13H2,1-3H3,(H,24,29)(H,25,30)(H,26,27,31) |
| InChIKey | DKUCAFHBBYYNIA-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 131.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.62 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|