C19H16Cl2N4O4S2 — CID 40832792
N-[5-[2-(3,4-dichloroanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-3,4-dimethoxybenzamide (PubChem CID 40832792) has the molecular formula C19H16Cl2N4O4S2 and a molecular weight of 499.40 g/mol. Its IUPAC name is N-[5-[2-(3,4-dichloroanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-3,4-dimethoxybenzamide.
| Compound Name | N-[5-[2-(3,4-dichloroanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 40832792 |
| Molecular Formula | C19H16Cl2N4O4S2 |
| Molecular Weight | 499.40 g/mol |
| Exact Mass | 498.00 |
| IUPAC Name | N-[5-[2-(3,4-dichloroanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-3,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)Nc2nnc(SCC(=O)Nc3ccc(Cl)c(Cl)c3)s2)cc1OC |
| InChI | InChI=1S/C19H16Cl2N4O4S2/c1-28-14-6-3-10(7-15(14)29-2)17(27)23-18-24-25-19(31-18)30-9-16(26)22-11-4-5-12(20)13(21)8-11/h3-8H,9H2,1-2H3,(H,22,26)(H,23,24,27) |
| InChIKey | LXMAUZKGQQKFBI-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 102.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.40 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|