C22H24N4O7S2 — CID 40832697
N-[5-[2-(3,4-dimethoxyanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-3,4,5-trimethoxybenzamide (PubChem CID 40832697) has the molecular formula C22H24N4O7S2 and a molecular weight of 520.59 g/mol. Its IUPAC name is N-[5-[2-(3,4-dimethoxyanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-3,4,5-trimethoxybenzamide.
| Compound Name | N-[5-[2-(3,4-dimethoxyanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 40832697 |
| Molecular Formula | C22H24N4O7S2 |
| Molecular Weight | 520.59 g/mol |
| Exact Mass | 520.11 |
| IUPAC Name | N-[5-[2-(3,4-dimethoxyanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-3,4,5-trimethoxybenzamide |
| SMILES | COc1ccc(NC(=O)CSc2nnc(NC(=O)c3cc(OC)c(OC)c(OC)c3)s2)cc1OC |
| InChI | InChI=1S/C22H24N4O7S2/c1-29-14-7-6-13(10-15(14)30-2)23-18(27)11-34-22-26-25-21(35-22)24-20(28)12-8-16(31-3)19(33-5)17(9-12)32-4/h6-10H,11H2,1-5H3,(H,23,27)(H,24,25,28) |
| InChIKey | HXOJSZRZYMDYSG-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 130.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.59 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|