C19H17N5O6S2 — CID 40832335
N-[5-[2-(3,4-dimethoxyanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-2-nitrobenzamide (PubChem CID 40832335) has the molecular formula C19H17N5O6S2 and a molecular weight of 475.51 g/mol. Its IUPAC name is N-[5-[2-(3,4-dimethoxyanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-2-nitrobenzamide.
| Compound Name | N-[5-[2-(3,4-dimethoxyanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-2-nitrobenzamide |
|---|---|
| PubChem CID | 40832335 |
| Molecular Formula | C19H17N5O6S2 |
| Molecular Weight | 475.51 g/mol |
| Exact Mass | 475.06 |
| IUPAC Name | N-[5-[2-(3,4-dimethoxyanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-2-nitrobenzamide |
| SMILES | COc1ccc(NC(=O)CSc2nnc(NC(=O)c3ccccc3[N+](=O)[O-])s2)cc1OC |
| InChI | InChI=1S/C19H17N5O6S2/c1-29-14-8-7-11(9-15(14)30-2)20-16(25)10-31-19-23-22-18(32-19)21-17(26)12-5-3-4-6-13(12)24(27)28/h3-9H,10H2,1-2H3,(H,20,25)(H,21,22,26) |
| InChIKey | JPZHFOCOARLEQM-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 145.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.51 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|