C20H18N4O5S2 — CID 42448243
N-[5-[2-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-2-methoxybenzamide (PubChem CID 42448243) has the molecular formula C20H18N4O5S2 and a molecular weight of 458.52 g/mol. Its IUPAC name is N-[5-[2-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-2-methoxybenzamide.
| Compound Name | N-[5-[2-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 42448243 |
| Molecular Formula | C20H18N4O5S2 |
| Molecular Weight | 458.52 g/mol |
| Exact Mass | 458.07 |
| IUPAC Name | N-[5-[2-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-2-methoxybenzamide |
| SMILES | COc1ccccc1C(=O)Nc1nnc(SCC(=O)Nc2ccc3c(c2)OCCO3)s1 |
| InChI | InChI=1S/C20H18N4O5S2/c1-27-14-5-3-2-4-13(14)18(26)22-19-23-24-20(31-19)30-11-17(25)21-12-6-7-15-16(10-12)29-9-8-28-15/h2-7,10H,8-9,11H2,1H3,(H,21,25)(H,22,23,26) |
| InChIKey | MFSGBLBZDHTXTR-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 111.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.52 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|