C17H13BrN4O5S2 — CID 18561145
5-bromo-N-[5-[2-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]furan-2-carboxamide (PubChem CID 18561145) has the molecular formula C17H13BrN4O5S2 and a molecular weight of 497.35 g/mol. Its IUPAC name is 5-bromo-N-[5-[2-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]furan-2-carboxamide.
| Compound Name | 5-bromo-N-[5-[2-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 18561145 |
| Molecular Formula | C17H13BrN4O5S2 |
| Molecular Weight | 497.35 g/mol |
| Exact Mass | 495.95 |
| IUPAC Name | 5-bromo-N-[5-[2-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]furan-2-carboxamide |
| SMILES | O=C(CSc1nnc(NC(=O)c2ccc(Br)o2)s1)Nc1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C17H13BrN4O5S2/c18-13-4-3-11(27-13)15(24)20-16-21-22-17(29-16)28-8-14(23)19-9-1-2-10-12(7-9)26-6-5-25-10/h1-4,7H,5-6,8H2,(H,19,23)(H,20,21,24) |
| InChIKey | SMRRWLIYZXGYEW-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 115.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.35 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|