C15H9BrCl2N4O3S2 — CID 40832585
5-bromo-N-[5-[2-(3,4-dichloroanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]furan-2-carboxamide (PubChem CID 40832585) has the molecular formula C15H9BrCl2N4O3S2 and a molecular weight of 508.21 g/mol. Its IUPAC name is 5-bromo-N-[5-[2-(3,4-dichloroanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]furan-2-carboxamide.
| Compound Name | 5-bromo-N-[5-[2-(3,4-dichloroanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 40832585 |
| Molecular Formula | C15H9BrCl2N4O3S2 |
| Molecular Weight | 508.21 g/mol |
| Exact Mass | 505.87 |
| IUPAC Name | 5-bromo-N-[5-[2-(3,4-dichloroanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]furan-2-carboxamide |
| SMILES | O=C(CSc1nnc(NC(=O)c2ccc(Br)o2)s1)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C15H9BrCl2N4O3S2/c16-11-4-3-10(25-11)13(24)20-14-21-22-15(27-14)26-6-12(23)19-7-1-2-8(17)9(18)5-7/h1-5H,6H2,(H,19,23)(H,20,21,24) |
| InChIKey | RFLITGAEJSTDPA-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 97.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.21 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|