C13H10Cl2N6OS4 — CID 23830012
2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-N-[5-[(3,4-dichlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]acetamide (PubChem CID 23830012) has the molecular formula C13H10Cl2N6OS4 and a molecular weight of 465.44 g/mol. Its IUPAC name is 2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-N-[5-[(3,4-dichlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]acetamide.
| Compound Name | 2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-N-[5-[(3,4-dichlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 23830012 |
| Molecular Formula | C13H10Cl2N6OS4 |
| Molecular Weight | 465.44 g/mol |
| Exact Mass | 463.92 |
| IUPAC Name | 2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-N-[5-[(3,4-dichlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]acetamide |
| SMILES | Nc1nnc(SCC(=O)Nc2nnc(SCc3ccc(Cl)c(Cl)c3)s2)s1 |
| InChI | InChI=1S/C13H10Cl2N6OS4/c14-7-2-1-6(3-8(7)15)4-23-13-21-19-11(26-13)17-9(22)5-24-12-20-18-10(16)25-12/h1-3H,4-5H2,(H2,16,18)(H,17,19,22) |
| InChIKey | APYOZKIUJJMCOM-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 106.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.44 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|